C27H48N2O7 — CID 90936682
4-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl-methylamino]butyl nitrate (PubChem CID 90936682) has the molecular formula C27H48N2O7 and a molecular weight of 512.69 g/mol. Its IUPAC name is 4-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl-methylamino]butyl nitrate.
| Compound Name | 4-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl-methylamino]butyl nitrate |
|---|---|
| PubChem CID | 90936682 |
| Molecular Formula | C27H48N2O7 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | 4-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl-methylamino]butyl nitrate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](CC=CCCCC(=O)N(C)CCCCO[N+](=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C27H48N2O7/c1-3-4-5-6-9-14-22(30)17-18-24-23(25(31)21-26(24)32)15-10-7-8-11-16-27(33)28(2)19-12-13-20-36-29(34)35/h7,10,23-26,31-32H,3-6,8-9,11-21H2,1-2H3/t23-,24-,25+,26-/m1/s1 |
| InChIKey | ONTAGIDWUCHMRU-FXSWLTOZSA-N |
| XLogP | 4.62 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|