C33H59N3O7 — CID 91003716
3-[1-[3-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]propyl]piperidin-4-yl]propyl nitrate (PubChem CID 91003716) has the molecular formula C33H59N3O7 and a molecular weight of 609.85 g/mol. Its IUPAC name is 3-[1-[3-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]propyl]piperidin-4-yl]propyl nitrate.
| Compound Name | 3-[1-[3-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]propyl]piperidin-4-yl]propyl nitrate |
|---|---|
| PubChem CID | 91003716 |
| Molecular Formula | C33H59N3O7 |
| Molecular Weight | 609.85 g/mol |
| Exact Mass | 609.44 |
| IUPAC Name | 3-[1-[3-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]propyl]piperidin-4-yl]propyl nitrate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](CC=CCCCC(=O)NCCCN2CCC(CCCO[N+](=O)[O-])CC2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C33H59N3O7/c1-2-3-4-5-8-14-28(37)17-18-30-29(31(38)26-32(30)39)15-9-6-7-10-16-33(40)34-21-12-22-35-23-19-27(20-24-35)13-11-25-43-36(41)42/h6,9,27,29-32,38-39H,2-5,7-8,10-26H2,1H3,(H,34,40)/t29-,30-,31+,32-/m1/s1 |
| InChIKey | NENDKTWODUBKAH-FEFKUCBWSA-N |
| XLogP | 5.38 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|