C31H57N3O8 — CID 70669069
2-[4-[3-(dihydroxyamino)oxypropyl]piperazin-1-yl]ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate (PubChem CID 70669069) has the molecular formula C31H57N3O8 and a molecular weight of 599.81 g/mol. Its IUPAC name is 2-[4-[3-(dihydroxyamino)oxypropyl]piperazin-1-yl]ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate.
| Compound Name | 2-[4-[3-(dihydroxyamino)oxypropyl]piperazin-1-yl]ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70669069 |
| Molecular Formula | C31H57N3O8 |
| Molecular Weight | 599.81 g/mol |
| Exact Mass | 599.41 |
| IUPAC Name | 2-[4-[3-(dihydroxyamino)oxypropyl]piperazin-1-yl]ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)OCCN2CCN(CCCON(O)O)CC2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C31H57N3O8/c1-2-3-4-5-8-12-26(35)15-16-28-27(29(36)25-30(28)37)13-9-6-7-10-14-31(38)41-24-22-33-20-18-32(19-21-33)17-11-23-42-34(39)40/h6,9,27-30,36-37,39-40H,2-5,7-8,10-25H2,1H3/b9-6-/t27-,28-,29+,30-/m1/s1 |
| InChIKey | VINZENDUZTUKRW-UBIFSANFSA-N |
| XLogP | 3.73 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|