C30H48N2O7 — CID 89069070
(Z)-N-[[4-[(dihydroxyamino)oxymethyl]phenyl]methyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enamide (PubChem CID 89069070) has the molecular formula C30H48N2O7 and a molecular weight of 548.72 g/mol. Its IUPAC name is (Z)-N-[[4-[(dihydroxyamino)oxymethyl]phenyl]methyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enamide.
| Compound Name | (Z)-N-[[4-[(dihydroxyamino)oxymethyl]phenyl]methyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 89069070 |
| Molecular Formula | C30H48N2O7 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | (Z)-N-[[4-[(dihydroxyamino)oxymethyl]phenyl]methyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enamide |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)NCc2ccc(CON(O)O)cc2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C30H48N2O7/c1-2-3-4-5-8-11-25(33)18-19-27-26(28(34)20-29(27)35)12-9-6-7-10-13-30(36)31-21-23-14-16-24(17-15-23)22-39-32(37)38/h6,9,14-17,26-29,34-35,37-38H,2-5,7-8,10-13,18-22H2,1H3,(H,31,36)/b9-6-/t26-,27-,28+,29-/m1/s1 |
| InChIKey | GJSOEYAAPXARHX-NPNFHEMVSA-N |
| XLogP | 5.00 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|