C30H46N2O5 — CID 143381010
[4-[[[(Z)-7-[2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]methyl]phenyl]methyl nitrate (PubChem CID 143381010) has the molecular formula C30H46N2O5 and a molecular weight of 514.71 g/mol. Its IUPAC name is [4-[[[(Z)-7-[2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]methyl]phenyl]methyl nitrate.
| Compound Name | [4-[[[(Z)-7-[2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]methyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 143381010 |
| Molecular Formula | C30H46N2O5 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | [4-[[[(Z)-7-[2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]methyl]phenyl]methyl nitrate |
| SMILES | CCCCCCCC(=O)CCC1CCCC1C/C=C\CCCC(=O)NCc1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H46N2O5/c1-2-3-4-5-9-15-29(33)22-21-28-14-11-13-27(28)12-8-6-7-10-16-30(34)31-23-25-17-19-26(20-18-25)24-37-32(35)36/h6,8,17-20,27-28H,2-5,7,9-16,21-24H2,1H3,(H,31,34)/b8-6- |
| InChIKey | CEFSIENGSUHKHC-VURMDHGXSA-N |
| XLogP | 7.25 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|