C26H46N2O7S — CID 91509703
2-[2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]ethylsulfanyl]ethyl nitrate (PubChem CID 91509703) has the molecular formula C26H46N2O7S and a molecular weight of 530.73 g/mol. Its IUPAC name is 2-[2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]ethylsulfanyl]ethyl nitrate.
| Compound Name | 2-[2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]ethylsulfanyl]ethyl nitrate |
|---|---|
| PubChem CID | 91509703 |
| Molecular Formula | C26H46N2O7S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 2-[2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]ethylsulfanyl]ethyl nitrate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](CC=CCCCC(=O)NCCSCCO[N+](=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C26H46N2O7S/c1-2-3-4-5-8-11-21(29)14-15-23-22(24(30)20-25(23)31)12-9-6-7-10-13-26(32)27-16-18-36-19-17-35-28(33)34/h6,9,22-25,30-31H,2-5,7-8,10-20H2,1H3,(H,27,32)/t22-,23-,24+,25-/m1/s1 |
| InChIKey | HPZKITKTLHFFQF-ZKGSSEMHSA-N |
| XLogP | 4.23 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|