C28H52N2O7 — CID 89069037
(Z)-N-[6-(dihydroxyamino)oxyhexyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enamide (PubChem CID 89069037) has the molecular formula C28H52N2O7 and a molecular weight of 528.73 g/mol. Its IUPAC name is (Z)-N-[6-(dihydroxyamino)oxyhexyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enamide.
| Compound Name | (Z)-N-[6-(dihydroxyamino)oxyhexyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 89069037 |
| Molecular Formula | C28H52N2O7 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (Z)-N-[6-(dihydroxyamino)oxyhexyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enamide |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)NCCCCCCON(O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C28H52N2O7/c1-2-3-4-5-10-15-23(31)18-19-25-24(26(32)22-27(25)33)16-11-6-7-12-17-28(34)29-20-13-8-9-14-21-37-30(35)36/h6,11,24-27,32-33,35-36H,2-5,7-10,12-22H2,1H3,(H,29,34)/b11-6-/t24-,25-,26+,27-/m1/s1 |
| InChIKey | YRSWAVUHAKZSCN-KTNXRSKJSA-N |
| XLogP | 4.86 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|