C36H55NO11 — CID 123960054
[2-methoxy-4-[2-(5-nitrooxypentanoyloxy)ethyl]phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate (PubChem CID 123960054) has the molecular formula C36H55NO11 and a molecular weight of 677.83 g/mol. Its IUPAC name is [2-methoxy-4-[2-(5-nitrooxypentanoyloxy)ethyl]phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate.
| Compound Name | [2-methoxy-4-[2-(5-nitrooxypentanoyloxy)ethyl]phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 123960054 |
| Molecular Formula | C36H55NO11 |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.38 |
| IUPAC Name | [2-methoxy-4-[2-(5-nitrooxypentanoyloxy)ethyl]phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](CC=CCCCC(=O)Oc2ccc(CCOC(=O)CCCCO[N+](=O)[O-])cc2OC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C36H55NO11/c1-3-4-5-6-9-14-28(38)19-20-30-29(31(39)26-32(30)40)15-10-7-8-11-17-36(42)48-33-21-18-27(25-34(33)45-2)22-24-46-35(41)16-12-13-23-47-37(43)44/h7,10,18,21,25,29-32,39-40H,3-6,8-9,11-17,19-20,22-24,26H2,1-2H3/t29-,30-,31+,32-/m1/s1 |
| InChIKey | UGIWWLITYHWXTH-FEFKUCBWSA-N |
| XLogP | 6.25 |
| TPSA | 171.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|