C18H32O — CID 59960771
4-[(1S,2S,3S,5R)-2-[(Z)-hept-2-enyl]-3,5-dimethylcyclopentyl]butan-2-one (PubChem CID 59960771) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is 4-[(1S,2S,3S,5R)-2-[(Z)-hept-2-enyl]-3,5-dimethylcyclopentyl]butan-2-one.
| Compound Name | 4-[(1S,2S,3S,5R)-2-[(Z)-hept-2-enyl]-3,5-dimethylcyclopentyl]butan-2-one |
|---|---|
| PubChem CID | 59960771 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 4-[(1S,2S,3S,5R)-2-[(Z)-hept-2-enyl]-3,5-dimethylcyclopentyl]butan-2-one |
| SMILES | CCCC/C=C\C[C@@H]1[C@@H](CCC(C)=O)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C18H32O/c1-5-6-7-8-9-10-17-14(2)13-15(3)18(17)12-11-16(4)19/h8-9,14-15,17-18H,5-7,10-13H2,1-4H3/b9-8-/t14-,15+,17-,18-/m0/s1 |
| InChIKey | RFNJLAGIZNIMAU-PFFBODNVSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|