C27H52O3Si — CID 157440626
(Z)-7-[(1S,2R,3R,5S)-5-methyl-2-octyl-3-triethylsilyloxycyclopentyl]hept-5-enoic acid (PubChem CID 157440626) has the molecular formula C27H52O3Si and a molecular weight of 452.80 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,3R,5S)-5-methyl-2-octyl-3-triethylsilyloxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,3R,5S)-5-methyl-2-octyl-3-triethylsilyloxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 157440626 |
| Molecular Formula | C27H52O3Si |
| Molecular Weight | 452.80 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | (Z)-7-[(1S,2R,3R,5S)-5-methyl-2-octyl-3-triethylsilyloxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCCCC[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](C)C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H52O3Si/c1-6-10-11-12-13-17-20-25-24(19-16-14-15-18-21-27(28)29)23(5)22-26(25)30-31(7-2,8-3)9-4/h14,16,23-26H,6-13,15,17-22H2,1-5H3,(H,28,29)/b16-14-/t23-,24-,25+,26+/m0/s1 |
| InChIKey | RTNHPWQURUPJDM-DTVQZHNSSA-N |
| XLogP | 8.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.80 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|