C35H69ClO3Si2 — CID 157480393
(Z)-7-[(1S,2R,3R,5S)-5-methyl-3-triethylsilyloxy-2-[(3S)-3-triethylsilyloxydecyl]cyclopentyl]hept-5-enoyl chloride (PubChem CID 157480393) has the molecular formula C35H69ClO3Si2 and a molecular weight of 629.56 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,3R,5S)-5-methyl-3-triethylsilyloxy-2-[(3S)-3-triethylsilyloxydecyl]cyclopentyl]hept-5-enoyl chloride.
| Compound Name | (Z)-7-[(1S,2R,3R,5S)-5-methyl-3-triethylsilyloxy-2-[(3S)-3-triethylsilyloxydecyl]cyclopentyl]hept-5-enoyl chloride |
|---|---|
| PubChem CID | 157480393 |
| Molecular Formula | C35H69ClO3Si2 |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 628.45 |
| IUPAC Name | (Z)-7-[(1S,2R,3R,5S)-5-methyl-3-triethylsilyloxy-2-[(3S)-3-triethylsilyloxydecyl]cyclopentyl]hept-5-enoyl chloride |
| SMILES | CCCCCCC[C@@H](CC[C@@H]1[C@@H](C/C=C\CCCC(=O)Cl)[C@@H](C)C[C@H]1O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C35H69ClO3Si2/c1-9-16-17-18-21-24-31(38-40(10-2,11-3)12-4)27-28-33-32(25-22-19-20-23-26-35(36)37)30(8)29-34(33)39-41(13-5,14-6)15-7/h19,22,30-34H,9-18,20-21,23-29H2,1-8H3/b22-19-/t30-,31-,32-,33+,34+/m0/s1 |
| InChIKey | KYMBBTLMLQBFDR-YYYQOBJVSA-N |
| XLogP | 12.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|