About (Z)-octadec-6-enoyl chloride
(Z)-octadec-6-enoyl chloride (PubChem CID 87496565) has the molecular formula C18H33ClO
and a molecular weight of 300.91 g/mol. Its IUPAC name is (Z)-octadec-6-enoyl chloride.
Molecular Properties
| Compound Name | (Z)-octadec-6-enoyl chloride |
| PubChem CID | 87496565 |
| Molecular Formula | C18H33ClO |
| Molecular Weight | 300.91 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (Z)-octadec-6-enoyl chloride |
| SMILES | CCCCCCCCCCC/C=C\CCCCC(=O)Cl |
| InChI | InChI=1S/C18H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h12-13H,2-11,14-17H2,1H3/b13-12- |
| InChIKey | ITHPEKLHWJURIR-SEYXRHQNSA-N |
| XLogP | 6.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.91 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-6-enoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-6-enoyl chloride?
The IUPAC name of (Z)-octadec-6-enoyl chloride (CID 87496565) is (Z)-octadec-6-enoyl chloride.
What is the SMILES notation for (Z)-octadec-6-enoyl chloride?
The canonical SMILES for (Z)-octadec-6-enoyl chloride is CCCCCCCCCCC/C=C\CCCCC(=O)Cl.
What is the InChIKey of (Z)-octadec-6-enoyl chloride?
The InChIKey is ITHPEKLHWJURIR-SEYXRHQNSA-N. The full InChI is InChI=1S/C18H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h12-13H,2-11,14-17H2,1H3/b13-12-.
What are the key properties of (Z)-octadec-6-enoyl chloride?
(Z)-octadec-6-enoyl chloride has a molecular weight of 300.91 g/mol, XLogP of 6.79, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-6-enoyl chloride is sourced from PubChem (CID 87496565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).