About (E)-hexadec-9-enoyl chloride
(E)-hexadec-9-enoyl chloride (PubChem CID 6272807) has the molecular formula C16H29ClO
and a molecular weight of 272.86 g/mol. Its IUPAC name is (E)-hexadec-9-enoyl chloride.
Molecular Properties
| Compound Name | (E)-hexadec-9-enoyl chloride |
| PubChem CID | 6272807 |
| Molecular Formula | C16H29ClO |
| Molecular Weight | 272.86 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (E)-hexadec-9-enoyl chloride |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)Cl |
| InChI | InChI=1S/C16H29ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3/b8-7+ |
| InChIKey | VZQFJZYVQNXVRY-BQYQJAHWSA-N |
| XLogP | 6.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.86 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-hexadec-9-enoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hexadec-9-enoyl chloride?
The IUPAC name of (E)-hexadec-9-enoyl chloride (CID 6272807) is (E)-hexadec-9-enoyl chloride.
What is the SMILES notation for (E)-hexadec-9-enoyl chloride?
The canonical SMILES for (E)-hexadec-9-enoyl chloride is CCCCCC/C=C/CCCCCCCC(=O)Cl.
What is the InChIKey of (E)-hexadec-9-enoyl chloride?
The InChIKey is VZQFJZYVQNXVRY-BQYQJAHWSA-N. The full InChI is InChI=1S/C16H29ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3/b8-7+.
What are the key properties of (E)-hexadec-9-enoyl chloride?
(E)-hexadec-9-enoyl chloride has a molecular weight of 272.86 g/mol, XLogP of 6.01, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hexadec-9-enoyl chloride is sourced from PubChem (CID 6272807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).