(Z)-heptadec-10-enoyl chloride

C17H31ClO — CID 14430044

IUPAC(Z)-heptadec-10-enoyl chloride
SMILESCCCCCC/C=C\CCCCCCCCC(=O)Cl
InChIInChI=1S/C17H31ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h7-8H,2-6,9-16H2,1H3/b8-7-
InChIKeyMBQCNBWBGIVTCZ-FPLPWBNLSA-N
MW286.89 g/mol
LogP6.40
Rot. Bonds14

About (Z)-heptadec-10-enoyl chloride

(Z)-heptadec-10-enoyl chloride (PubChem CID 14430044) has the molecular formula C17H31ClO and a molecular weight of 286.89 g/mol. Its IUPAC name is (Z)-heptadec-10-enoyl chloride.

Molecular Properties

Compound Name(Z)-heptadec-10-enoyl chloride
PubChem CID14430044
Molecular FormulaC17H31ClO
Molecular Weight286.89 g/mol
Exact Mass286.21
IUPAC Name(Z)-heptadec-10-enoyl chloride
SMILESCCCCCC/C=C\CCCCCCCCC(=O)Cl
InChIInChI=1S/C17H31ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h7-8H,2-6,9-16H2,1H3/b8-7-
InChIKeyMBQCNBWBGIVTCZ-FPLPWBNLSA-N
XLogP6.40
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds14
Heavy Atoms19
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500286.89
LogP ≤ 56.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-heptadec-10-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-heptadec-10-enoyl chloride?
The IUPAC name of (Z)-heptadec-10-enoyl chloride (CID 14430044) is (Z)-heptadec-10-enoyl chloride.
What is the SMILES notation for (Z)-heptadec-10-enoyl chloride?
The canonical SMILES for (Z)-heptadec-10-enoyl chloride is CCCCCC/C=C\CCCCCCCCC(=O)Cl.
What is the InChIKey of (Z)-heptadec-10-enoyl chloride?
The InChIKey is MBQCNBWBGIVTCZ-FPLPWBNLSA-N. The full InChI is InChI=1S/C17H31ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h7-8H,2-6,9-16H2,1H3/b8-7-.
What are the key properties of (Z)-heptadec-10-enoyl chloride?
(Z)-heptadec-10-enoyl chloride has a molecular weight of 286.89 g/mol, XLogP of 6.40, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-heptadec-10-enoyl chloride is sourced from PubChem (CID 14430044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).