About (Z)-octadec-9-enoyl chloride;dihydrochloride
(Z)-octadec-9-enoyl chloride;dihydrochloride (PubChem CID 141041572) has the molecular formula C18H35Cl3O
and a molecular weight of 373.84 g/mol. Its IUPAC name is (Z)-octadec-9-enoyl chloride;dihydrochloride.
Molecular Properties
| Compound Name | (Z)-octadec-9-enoyl chloride;dihydrochloride |
| PubChem CID | 141041572 |
| Molecular Formula | C18H35Cl3O |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (Z)-octadec-9-enoyl chloride;dihydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Cl.Cl.Cl |
| InChI | InChI=1S/C18H33ClO.2ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;/h9-10H,2-8,11-17H2,1H3;2*1H/b10-9-;; |
| InChIKey | HRYKFUDKXPTQMI-XXAVUKJNSA-N |
| XLogP | 7.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-enoyl chloride;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-enoyl chloride;dihydrochloride?
The IUPAC name of (Z)-octadec-9-enoyl chloride;dihydrochloride (CID 141041572) is (Z)-octadec-9-enoyl chloride;dihydrochloride.
What is the SMILES notation for (Z)-octadec-9-enoyl chloride;dihydrochloride?
The canonical SMILES for (Z)-octadec-9-enoyl chloride;dihydrochloride is CCCCCCCC/C=C\CCCCCCCC(=O)Cl.Cl.Cl.
What is the InChIKey of (Z)-octadec-9-enoyl chloride;dihydrochloride?
The InChIKey is HRYKFUDKXPTQMI-XXAVUKJNSA-N. The full InChI is InChI=1S/C18H33ClO.2ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;/h9-10H,2-8,11-17H2,1H3;2*1H/b10-9-;;.
What are the key properties of (Z)-octadec-9-enoyl chloride;dihydrochloride?
(Z)-octadec-9-enoyl chloride;dihydrochloride has a molecular weight of 373.84 g/mol, XLogP of 7.63, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-enoyl chloride;dihydrochloride is sourced from PubChem (CID 141041572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).