About (Z)-hexadec-9-enoic acid;hydrochloride
(Z)-hexadec-9-enoic acid;hydrochloride (PubChem CID 88612066) has the molecular formula C16H31ClO2
and a molecular weight of 290.87 g/mol. Its IUPAC name is (Z)-hexadec-9-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | (Z)-hexadec-9-enoic acid;hydrochloride |
| PubChem CID | 88612066 |
| Molecular Formula | C16H31ClO2 |
| Molecular Weight | 290.87 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (Z)-hexadec-9-enoic acid;hydrochloride |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)O.Cl |
| InChI | InChI=1S/C16H30O2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h7-8H,2-6,9-15H2,1H3,(H,17,18);1H/b8-7-; |
| InChIKey | FSNTVURKXZCOGP-CFYXSCKTSA-N |
| XLogP | 5.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-hexadec-9-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-hexadec-9-enoic acid;hydrochloride?
The IUPAC name of (Z)-hexadec-9-enoic acid;hydrochloride (CID 88612066) is (Z)-hexadec-9-enoic acid;hydrochloride.
What is the SMILES notation for (Z)-hexadec-9-enoic acid;hydrochloride?
The canonical SMILES for (Z)-hexadec-9-enoic acid;hydrochloride is CCCCCC/C=C\CCCCCCCC(=O)O.Cl.
What is the InChIKey of (Z)-hexadec-9-enoic acid;hydrochloride?
The InChIKey is FSNTVURKXZCOGP-CFYXSCKTSA-N. The full InChI is InChI=1S/C16H30O2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h7-8H,2-6,9-15H2,1H3,(H,17,18);1H/b8-7-;.
What are the key properties of (Z)-hexadec-9-enoic acid;hydrochloride?
(Z)-hexadec-9-enoic acid;hydrochloride has a molecular weight of 290.87 g/mol, XLogP of 5.75, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-hexadec-9-enoic acid;hydrochloride is sourced from PubChem (CID 88612066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).