C49H76O8 — CID 134215474
[(4Z,7Z,10Z,13Z,16Z,19Z)-henicosa-4,7,10,13,16,19-hexaenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[(3S)-3-acetyloxydecyl]cyclopentyl]hept-5-enoate (PubChem CID 134215474) has the molecular formula C49H76O8 and a molecular weight of 793.14 g/mol. Its IUPAC name is [(4Z,7Z,10Z,13Z,16Z,19Z)-henicosa-4,7,10,13,16,19-hexaenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[(3S)-3-acetyloxydecyl]cyclopentyl]hept-5-enoate.
| Compound Name | [(4Z,7Z,10Z,13Z,16Z,19Z)-henicosa-4,7,10,13,16,19-hexaenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[(3S)-3-acetyloxydecyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 134215474 |
| Molecular Formula | C49H76O8 |
| Molecular Weight | 793.14 g/mol |
| Exact Mass | 792.55 |
| IUPAC Name | [(4Z,7Z,10Z,13Z,16Z,19Z)-henicosa-4,7,10,13,16,19-hexaenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-diacetyloxy-2-[(3S)-3-acetyloxydecyl]cyclopentyl]hept-5-enoate |
| SMILES | C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCOC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@H](CCCCCCC)OC(C)=O)[C@H](OC(C)=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C49H76O8/c1-6-8-10-12-13-14-15-16-17-18-19-20-21-22-23-24-25-29-33-39-54-49(53)36-32-28-27-31-35-45-46(48(57-43(5)52)40-47(45)56-42(4)51)38-37-44(55-41(3)50)34-30-26-11-9-7-2/h6,8,12-13,15-16,18-19,21-22,24-25,27,31,44-48H,7,9-11,14,17,20,23,26,28-30,32-40H2,1-5H3/b8-6-,13-12-,16-15-,19-18-,22-21-,25-24-,31-27-/t44-,45+,46+,47-,48+/m0/s1 |
| InChIKey | AXYXZTVCUJLVTM-WZLGKWNUSA-N |
| XLogP | 12.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.14 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|