C29H46O8 — CID 88764588
[(1S,2R,3R,4R)-4-acetyloxy-2-[(4E,6E)-7-acetyloxyocta-4,6-dienyl]-3-[(3S)-3-acetyloxyoctyl]cyclopentyl] acetate (PubChem CID 88764588) has the molecular formula C29H46O8 and a molecular weight of 522.68 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-4-acetyloxy-2-[(4E,6E)-7-acetyloxyocta-4,6-dienyl]-3-[(3S)-3-acetyloxyoctyl]cyclopentyl] acetate.
| Compound Name | [(1S,2R,3R,4R)-4-acetyloxy-2-[(4E,6E)-7-acetyloxyocta-4,6-dienyl]-3-[(3S)-3-acetyloxyoctyl]cyclopentyl] acetate |
|---|---|
| PubChem CID | 88764588 |
| Molecular Formula | C29H46O8 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | [(1S,2R,3R,4R)-4-acetyloxy-2-[(4E,6E)-7-acetyloxyocta-4,6-dienyl]-3-[(3S)-3-acetyloxyoctyl]cyclopentyl] acetate |
| SMILES | CCCCC[C@@H](CC[C@@H]1[C@@H](CCC/C=C/C=C(\C)OC(C)=O)[C@@H](OC(C)=O)C[C@H]1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C29H46O8/c1-7-8-11-15-25(35-22(4)31)17-18-27-26(16-13-10-9-12-14-20(2)34-21(3)30)28(36-23(5)32)19-29(27)37-24(6)33/h9,12,14,25-29H,7-8,10-11,13,15-19H2,1-6H3/b12-9+,20-14+/t25-,26+,27+,28-,29+/m0/s1 |
| InChIKey | JKYBKZCGELAJTL-GFHWFMJVSA-N |
| XLogP | 5.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|