C21H36O3 — CID 57435742
[(11E,13E)-18-oxononadeca-11,13-dien-7-yl] acetate (PubChem CID 57435742) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is [(11E,13E)-18-oxononadeca-11,13-dien-7-yl] acetate.
| Compound Name | [(11E,13E)-18-oxononadeca-11,13-dien-7-yl] acetate |
|---|---|
| PubChem CID | 57435742 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | [(11E,13E)-18-oxononadeca-11,13-dien-7-yl] acetate |
| SMILES | CCCCCCC(CCC/C=C/C=C/CCCC(C)=O)OC(C)=O |
| InChI | InChI=1S/C21H36O3/c1-4-5-6-14-17-21(24-20(3)23)18-15-12-10-8-7-9-11-13-16-19(2)22/h7-10,21H,4-6,11-18H2,1-3H3/b9-7+,10-8+ |
| InChIKey | ROLRRGPSTMRGJQ-FIFLTTCUSA-N |
| XLogP | 5.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|