About 14-oxopentadec-9-en-3-yl acetate
14-oxopentadec-9-en-3-yl acetate (PubChem CID 76539150) has the molecular formula C17H30O3
and a molecular weight of 282.42 g/mol. Its IUPAC name is 14-oxopentadec-9-en-3-yl acetate.
Molecular Properties
| Compound Name | 14-oxopentadec-9-en-3-yl acetate |
| PubChem CID | 76539150 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 14-oxopentadec-9-en-3-yl acetate |
| SMILES | CCC(CCCCCC=CCCCC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H30O3/c1-4-17(20-16(3)19)14-12-10-8-6-5-7-9-11-13-15(2)18/h5,7,17H,4,6,8-14H2,1-3H3 |
| InChIKey | VWRPGUKCMHLKFK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 14-oxopentadec-9-en-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-oxopentadec-9-en-3-yl acetate?
The IUPAC name of 14-oxopentadec-9-en-3-yl acetate (CID 76539150) is 14-oxopentadec-9-en-3-yl acetate.
What is the SMILES notation for 14-oxopentadec-9-en-3-yl acetate?
The canonical SMILES for 14-oxopentadec-9-en-3-yl acetate is CCC(CCCCCC=CCCCC(C)=O)OC(C)=O.
What is the InChIKey of 14-oxopentadec-9-en-3-yl acetate?
The InChIKey is VWRPGUKCMHLKFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O3/c1-4-17(20-16(3)19)14-12-10-8-6-5-7-9-11-13-15(2)18/h5,7,17H,4,6,8-14H2,1-3H3.
What are the key properties of 14-oxopentadec-9-en-3-yl acetate?
14-oxopentadec-9-en-3-yl acetate has a molecular weight of 282.42 g/mol, XLogP of 4.59, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 14-oxopentadec-9-en-3-yl acetate is sourced from PubChem (CID 76539150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).