C20H32F2O5 — CID 70432441
5-[(3aR,4R)-3-fluoro-4-(4-fluoro-3-hydroxyoctyl)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoic acid (PubChem CID 70432441) has the molecular formula C20H32F2O5 and a molecular weight of 390.47 g/mol. Its IUPAC name is 5-[(3aR,4R)-3-fluoro-4-(4-fluoro-3-hydroxyoctyl)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoic acid.
| Compound Name | 5-[(3aR,4R)-3-fluoro-4-(4-fluoro-3-hydroxyoctyl)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 70432441 |
| Molecular Formula | C20H32F2O5 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 5-[(3aR,4R)-3-fluoro-4-(4-fluoro-3-hydroxyoctyl)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pent-4-enoic acid |
| SMILES | CCCCC(F)C(O)CC[C@H]1C(O)CC2OC(C=CCCC(=O)O)C(F)[C@@H]21 |
| InChI | InChI=1S/C20H32F2O5/c1-2-3-6-13(21)14(23)10-9-12-15(24)11-17-19(12)20(22)16(27-17)7-4-5-8-18(25)26/h4,7,12-17,19-20,23-24H,2-3,5-6,8-11H2,1H3,(H,25,26)/t12-,13?,14?,15?,16?,17?,19+,20?/m0/s1 |
| InChIKey | XNTJJDPIGZMULI-XIKCCTIFSA-N |
| XLogP | 3.18 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|