C30H45NO5 — CID 58231690
[(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] pentanoate (PubChem CID 58231690) has the molecular formula C30H45NO5 and a molecular weight of 499.69 g/mol. Its IUPAC name is [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] pentanoate.
| Compound Name | [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] pentanoate |
|---|---|
| PubChem CID | 58231690 |
| Molecular Formula | C30H45NO5 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)NCC)[C@@H](O)C[C@H]1O)CCc1ccccc1 |
| InChI | InChI=1S/C30H45NO5/c1-3-5-17-30(35)36-24(19-18-23-13-9-8-10-14-23)20-21-26-25(27(32)22-28(26)33)15-11-6-7-12-16-29(34)31-4-2/h6,8-11,13-14,20-21,24-28,32-33H,3-5,7,12,15-19,22H2,1-2H3,(H,31,34)/b11-6-,21-20+/t24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | FYBBAIILFPTJFD-NSYDRDQNSA-N |
| XLogP | 4.89 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|