C25H42O6 — CID 102330131
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-pentanoyloxyoct-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 102330131) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-pentanoyloxyoct-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-pentanoyloxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 102330131 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-pentanoyloxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O)OC(=O)CCCC |
| InChI | InChI=1S/C25H42O6/c1-3-5-9-12-19(31-25(30)15-6-4-2)16-17-21-20(22(26)18-23(21)27)13-10-7-8-11-14-24(28)29/h7,10,16-17,19-23,26-27H,3-6,8-9,11-15,18H2,1-2H3,(H,28,29)/b10-7-,17-16+/t19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | YVOODDACIMYJFT-DHSBKHEBSA-N |
| XLogP | 4.78 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|