C30H44N2O8 — CID 66676057
[1-[(1R,2R,3S,5R)-2-[7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 5-nitrooxypentanoate (PubChem CID 66676057) has the molecular formula C30H44N2O8 and a molecular weight of 560.69 g/mol. Its IUPAC name is [1-[(1R,2R,3S,5R)-2-[7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 5-nitrooxypentanoate.
| Compound Name | [1-[(1R,2R,3S,5R)-2-[7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 5-nitrooxypentanoate |
|---|---|
| PubChem CID | 66676057 |
| Molecular Formula | C30H44N2O8 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | [1-[(1R,2R,3S,5R)-2-[7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 5-nitrooxypentanoate |
| SMILES | CCNC(=O)CCCC=CC[C@@H]1[C@@H](C=CC(CCc2ccccc2)OC(=O)CCCCO[N+](=O)[O-])[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H44N2O8/c1-2-31-29(35)15-9-4-3-8-14-25-26(28(34)22-27(25)33)20-19-24(18-17-23-12-6-5-7-13-23)40-30(36)16-10-11-21-39-32(37)38/h3,5-8,12-13,19-20,24-28,33-34H,2,4,9-11,14-18,21-22H2,1H3,(H,31,35)/t24?,25-,26-,27+,28-/m1/s1 |
| InChIKey | PQSNBCZBAZNYML-DPFFOKIGSA-N |
| XLogP | 4.08 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|