C31H48N2O6 — CID 164855443
[(E)-1-cyclopentyl-5-phenylpent-1-en-3-yl] 6-nitrooxyhexanoate;(Z)-N-ethylhept-5-enamide (PubChem CID 164855443) has the molecular formula C31H48N2O6 and a molecular weight of 544.73 g/mol. Its IUPAC name is [(E)-1-cyclopentyl-5-phenylpent-1-en-3-yl] 6-nitrooxyhexanoate;(Z)-N-ethylhept-5-enamide.
| Compound Name | [(E)-1-cyclopentyl-5-phenylpent-1-en-3-yl] 6-nitrooxyhexanoate;(Z)-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 164855443 |
| Molecular Formula | C31H48N2O6 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | [(E)-1-cyclopentyl-5-phenylpent-1-en-3-yl] 6-nitrooxyhexanoate;(Z)-N-ethylhept-5-enamide |
| SMILES | C/C=C\CCCC(=O)NCC.O=C(CCCCCO[N+](=O)[O-])OC(/C=C/C1CCCC1)CCc1ccccc1 |
| InChI | InChI=1S/C22H31NO5.C9H17NO/c24-22(13-5-2-8-18-27-23(25)26)28-21(17-15-20-11-6-7-12-20)16-14-19-9-3-1-4-10-19;1-3-5-6-7-8-9(11)10-4-2/h1,3-4,9-10,15,17,20-21H,2,5-8,11-14,16,18H2;3,5H,4,6-8H2,1-2H3,(H,10,11)/b17-15+;5-3- |
| InChIKey | AAXLKYJMEJLUEN-YLVKFYBPSA-N |
| XLogP | 6.91 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|