C40H69NO7 — CID 145386549
[(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;tris(oxan-2-ol) (PubChem CID 145386549) has the molecular formula C40H69NO7 and a molecular weight of 675.99 g/mol. Its IUPAC name is [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;tris(oxan-2-ol).
| Compound Name | [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;tris(oxan-2-ol) |
|---|---|
| PubChem CID | 145386549 |
| Molecular Formula | C40H69NO7 |
| Molecular Weight | 675.99 g/mol |
| Exact Mass | 675.51 |
| IUPAC Name | [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;tris(oxan-2-ol) |
| SMILES | C(=C/C1CCCC1)\CCCc1ccccc1.C/C=C\CCCC(=O)NCC.OC1CCCCO1.OC1CCCCO1.OC1CCCCO1 |
| InChI | InChI=1S/C16H22.C9H17NO.3C5H10O2/c1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-16;1-3-5-6-7-8-9(11)10-4-2;3*6-5-3-1-2-4-7-5/h1,3-4,6,9-10,12,16H,2,5,7-8,11,13-14H2;3,5H,4,6-8H2,1-2H3,(H,10,11);3*5-6H,1-4H2/b12-6+;5-3-;;; |
| InChIKey | KQISCWAOVANKQW-KCNAMTLISA-N |
| XLogP | 8.14 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.99 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|