C28H46O3 — CID 143896573
[(E)-5-cyclohexylpent-4-enyl]benzene;methanol;propan-2-yl (Z)-hept-5-enoate (PubChem CID 143896573) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is [(E)-5-cyclohexylpent-4-enyl]benzene;methanol;propan-2-yl (Z)-hept-5-enoate.
| Compound Name | [(E)-5-cyclohexylpent-4-enyl]benzene;methanol;propan-2-yl (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 143896573 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | [(E)-5-cyclohexylpent-4-enyl]benzene;methanol;propan-2-yl (Z)-hept-5-enoate |
| SMILES | C(=C/C1CCCCC1)\CCCc1ccccc1.C/C=C\CCCC(=O)OC(C)C.CO |
| InChI | InChI=1S/C17H24.C10H18O2.CH4O/c1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17;1-4-5-6-7-8-10(11)12-9(2)3;1-2/h1,4-5,9-11,15,17H,2-3,6-8,12-14H2;4-5,9H,6-8H2,1-3H3;2H,1H3/b15-9+;5-4-; |
| InChIKey | RVPWXRKPQZJRTF-DUYDQFCUSA-N |
| XLogP | 7.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|