About (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol
(Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol (PubChem CID 144501828) has the molecular formula C25H39NO2
and a molecular weight of 385.59 g/mol. Its IUPAC name is (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol |
| PubChem CID | 144501828 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol |
| SMILES | C/C=C\CCCC(=O)NCC.OC1CCCC1/C=C/CCCc1ccccc1 |
| InChI | InChI=1S/C16H22O.C9H17NO/c17-16-13-7-12-15(16)11-6-2-5-10-14-8-3-1-4-9-14;1-3-5-6-7-8-9(11)10-4-2/h1,3-4,6,8-9,11,15-17H,2,5,7,10,12-13H2;3,5H,4,6-8H2,1-2H3,(H,10,11)/b11-6+;5-3- |
| InChIKey | AWMFKTUSKWRPIC-QXYWGVEISA-N |
| XLogP | 5.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol?
The IUPAC name of (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol (CID 144501828) is (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol.
What is the SMILES notation for (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol?
The canonical SMILES for (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol is C/C=C\CCCC(=O)NCC.OC1CCCC1/C=C/CCCc1ccccc1.
What is the InChIKey of (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol?
The InChIKey is AWMFKTUSKWRPIC-QXYWGVEISA-N. The full InChI is InChI=1S/C16H22O.C9H17NO/c17-16-13-7-12-15(16)11-6-2-5-10-14-8-3-1-4-9-14;1-3-5-6-7-8-9(11)10-4-2/h1,3-4,6,8-9,11,15-17H,2,5,7,10,12-13H2;3,5H,4,6-8H2,1-2H3,(H,10,11)/b11-6+;5-3-.
What are the key properties of (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol?
(Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol has a molecular weight of 385.59 g/mol, XLogP of 5.60, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethylhept-5-enamide;2-[(E)-5-phenylpent-1-enyl]cyclopentan-1-ol is sourced from PubChem (CID 144501828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).