C22H32O2 — CID 144709528
(Z)-6-[2-(5-phenylpentyl)cyclopentyl]hex-5-enoic acid (PubChem CID 144709528) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (Z)-6-[2-(5-phenylpentyl)cyclopentyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[2-(5-phenylpentyl)cyclopentyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 144709528 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (Z)-6-[2-(5-phenylpentyl)cyclopentyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C1CCCC1CCCCCc1ccccc1 |
| InChI | InChI=1S/C22H32O2/c23-22(24)18-9-3-8-15-21-17-10-16-20(21)14-7-2-6-13-19-11-4-1-5-12-19/h1,4-5,8,11-12,15,20-21H,2-3,6-7,9-10,13-14,16-18H2,(H,23,24)/b15-8- |
| InChIKey | UTOBRKLCSWBPQZ-NVNXTCNLSA-N |
| XLogP | 6.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|