C20H36O2 — CID 54234183
7-(2-oct-1-enylcyclopentyl)heptanoic acid (PubChem CID 54234183) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 7-(2-oct-1-enylcyclopentyl)heptanoic acid.
| Compound Name | 7-(2-oct-1-enylcyclopentyl)heptanoic acid |
|---|---|
| PubChem CID | 54234183 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 7-(2-oct-1-enylcyclopentyl)heptanoic acid |
| SMILES | CCCCCCC=CC1CCCC1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H36O2/c1-2-3-4-5-6-9-13-18-15-12-16-19(18)14-10-7-8-11-17-20(21)22/h9,13,18-19H,2-8,10-12,14-17H2,1H3,(H,21,22) |
| InChIKey | QLJCPRYAASBIGP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|