C24H41FO2 — CID 57014423
6-[[(1R,2S)-2-dec-1-enylcyclopentyl]methyl]-7-fluorooct-7-enoic acid (PubChem CID 57014423) has the molecular formula C24H41FO2 and a molecular weight of 380.59 g/mol. Its IUPAC name is 6-[[(1R,2S)-2-dec-1-enylcyclopentyl]methyl]-7-fluorooct-7-enoic acid.
| Compound Name | 6-[[(1R,2S)-2-dec-1-enylcyclopentyl]methyl]-7-fluorooct-7-enoic acid |
|---|---|
| PubChem CID | 57014423 |
| Molecular Formula | C24H41FO2 |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 6-[[(1R,2S)-2-dec-1-enylcyclopentyl]methyl]-7-fluorooct-7-enoic acid |
| SMILES | C=C(F)C(CCCCC(=O)O)C[C@H]1CCC[C@@H]1C=CCCCCCCCC |
| InChI | InChI=1S/C24H41FO2/c1-3-4-5-6-7-8-9-10-14-21-16-13-17-23(21)19-22(20(2)25)15-11-12-18-24(26)27/h10,14,21-23H,2-9,11-13,15-19H2,1H3,(H,26,27)/t21-,22?,23+/m0/s1 |
| InChIKey | SOLWLSCVXIFTAR-OCESARCHSA-N |
| XLogP | 7.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|