C21H37IO2 — CID 154143928
methyl 2-iodo-7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptanoate (PubChem CID 154143928) has the molecular formula C21H37IO2 and a molecular weight of 448.43 g/mol. Its IUPAC name is methyl 2-iodo-7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptanoate.
| Compound Name | methyl 2-iodo-7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptanoate |
|---|---|
| PubChem CID | 154143928 |
| Molecular Formula | C21H37IO2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl 2-iodo-7-[(1S,2S)-2-oct-1-enylcyclopentyl]heptanoate |
| SMILES | CCCCCCC=C[C@H]1CCC[C@@H]1CCCCCC(I)C(=O)OC |
| InChI | InChI=1S/C21H37IO2/c1-3-4-5-6-7-9-13-18-15-12-16-19(18)14-10-8-11-17-20(22)21(23)24-2/h9,13,18-20H,3-8,10-12,14-17H2,1-2H3/t18-,19-,20?/m0/s1 |
| InChIKey | XKQYAQZZPIPWHT-NFBCFJMWSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|