C26H44O4 — CID 70519486
methyl 7-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate (PubChem CID 70519486) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is methyl 7-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate |
|---|---|
| PubChem CID | 70519486 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | methyl 7-[(1R,2S)-2-oct-1-enylcyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate |
| SMILES | CCCCCCC=C[C@H]1CCC[C@@H]1CC=CCCC(OC1CCCCO1)C(=O)OC |
| InChI | InChI=1S/C26H44O4/c1-3-4-5-6-7-9-15-22-17-14-18-23(22)16-10-8-11-19-24(26(27)28-2)30-25-20-12-13-21-29-25/h8-10,15,22-25H,3-7,11-14,16-21H2,1-2H3/t22-,23-,24?,25?/m0/s1 |
| InChIKey | BGCDBQOWUVYEAL-HHLXFHKQSA-N |
| XLogP | 6.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|