C27H46O4 — CID 154478842
7-[(1S,2S)-2-(5-methylnon-1-enyl)cyclopentyl]-2-(oxan-2-yloxy)hept-2-enoic acid (PubChem CID 154478842) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is 7-[(1S,2S)-2-(5-methylnon-1-enyl)cyclopentyl]-2-(oxan-2-yloxy)hept-2-enoic acid.
| Compound Name | 7-[(1S,2S)-2-(5-methylnon-1-enyl)cyclopentyl]-2-(oxan-2-yloxy)hept-2-enoic acid |
|---|---|
| PubChem CID | 154478842 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 7-[(1S,2S)-2-(5-methylnon-1-enyl)cyclopentyl]-2-(oxan-2-yloxy)hept-2-enoic acid |
| SMILES | CCCCC(C)CCC=C[C@H]1CCC[C@@H]1CCCCC=C(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C27H46O4/c1-3-4-13-22(2)14-8-9-16-24-18-12-17-23(24)15-6-5-7-19-25(27(28)29)31-26-20-10-11-21-30-26/h9,16,19,22-24,26H,3-8,10-15,17-18,20-21H2,1-2H3,(H,28,29)/t22?,23-,24-,26?/m0/s1 |
| InChIKey | XIKKHZCWJZSPFW-GGHGPYORSA-N |
| XLogP | 7.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|