C25H44O3 — CID 154152557
7-[(1R,2S)-2-octylcyclopentyl]-1-(oxan-2-yloxy)hepta-1,3-dien-1-ol (PubChem CID 154152557) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is 7-[(1R,2S)-2-octylcyclopentyl]-1-(oxan-2-yloxy)hepta-1,3-dien-1-ol.
| Compound Name | 7-[(1R,2S)-2-octylcyclopentyl]-1-(oxan-2-yloxy)hepta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 154152557 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 7-[(1R,2S)-2-octylcyclopentyl]-1-(oxan-2-yloxy)hepta-1,3-dien-1-ol |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CCCC=CC=C(O)OC1CCCCO1 |
| InChI | InChI=1S/C25H44O3/c1-2-3-4-5-6-9-15-22-17-14-18-23(22)16-10-7-8-11-19-24(26)28-25-20-12-13-21-27-25/h8,11,19,22-23,25-26H,2-7,9-10,12-18,20-21H2,1H3/t22-,23-,25?/m0/s1 |
| InChIKey | UXGJTLJRETWOMF-REQUTJCGSA-N |
| XLogP | 7.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|