C21H40O — CID 54030734
8-[(1S,2S)-2-octylcyclopentyl]oct-2-en-1-ol (PubChem CID 54030734) has the molecular formula C21H40O and a molecular weight of 308.55 g/mol. Its IUPAC name is 8-[(1S,2S)-2-octylcyclopentyl]oct-2-en-1-ol.
| Compound Name | 8-[(1S,2S)-2-octylcyclopentyl]oct-2-en-1-ol |
|---|---|
| PubChem CID | 54030734 |
| Molecular Formula | C21H40O |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.31 |
| IUPAC Name | 8-[(1S,2S)-2-octylcyclopentyl]oct-2-en-1-ol |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CCCCCC=CCO |
| InChI | InChI=1S/C21H40O/c1-2-3-4-5-8-11-15-20-17-14-18-21(20)16-12-9-6-7-10-13-19-22/h10,13,20-22H,2-9,11-12,14-19H2,1H3/t20-,21-/m0/s1 |
| InChIKey | LFKCNBDZAMNMBR-SFTDATJTSA-N |
| XLogP | 6.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|