C25H42O4 — CID 22801306
(Z)-2-[(E)-5-cyclopentylpent-3-enyl]-3-(oxan-2-yloxy)dec-3-enoic acid (PubChem CID 22801306) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is (Z)-2-[(E)-5-cyclopentylpent-3-enyl]-3-(oxan-2-yloxy)dec-3-enoic acid.
| Compound Name | (Z)-2-[(E)-5-cyclopentylpent-3-enyl]-3-(oxan-2-yloxy)dec-3-enoic acid |
|---|---|
| PubChem CID | 22801306 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (Z)-2-[(E)-5-cyclopentylpent-3-enyl]-3-(oxan-2-yloxy)dec-3-enoic acid |
| SMILES | CCCCCC/C=C(\OC1CCCCO1)C(CC/C=C/CC1CCCC1)C(=O)O |
| InChI | InChI=1S/C25H42O4/c1-2-3-4-5-9-18-23(29-24-19-12-13-20-28-24)22(25(26)27)17-8-6-7-14-21-15-10-11-16-21/h6-7,18,21-22,24H,2-5,8-17,19-20H2,1H3,(H,26,27)/b7-6+,23-18- |
| InChIKey | SSJVTUNXBRDVJB-PUDIDAECSA-N |
| XLogP | 7.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|