C28H48O4 — CID 154307217
methyl 7-[(1R,2S)-2-(4,4-dimethyloct-1-enyl)cyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate (PubChem CID 154307217) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is methyl 7-[(1R,2S)-2-(4,4-dimethyloct-1-enyl)cyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S)-2-(4,4-dimethyloct-1-enyl)cyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate |
|---|---|
| PubChem CID | 154307217 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | methyl 7-[(1R,2S)-2-(4,4-dimethyloct-1-enyl)cyclopentyl]-2-(oxan-2-yloxy)hept-5-enoate |
| SMILES | CCCCC(C)(C)CC=C[C@H]1CCC[C@@H]1CC=CCCC(OC1CCCCO1)C(=O)OC |
| InChI | InChI=1S/C28H48O4/c1-5-6-20-28(2,3)21-13-17-24-16-12-15-23(24)14-8-7-9-18-25(27(29)30-4)32-26-19-10-11-22-31-26/h7-8,13,17,23-26H,5-6,9-12,14-16,18-22H2,1-4H3/t23-,24+,25?,26?/m0/s1 |
| InChIKey | UFOCONLWMHCXFX-BZPMOENQSA-N |
| XLogP | 7.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|