C22H37BrO4 — CID 57112859
3-bromo-7-[(1R,2S)-2-(4,4-dimethyloct-1-enyl)cyclopentyl]-2,2-dihydroxyhept-5-enoic acid (PubChem CID 57112859) has the molecular formula C22H37BrO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is 3-bromo-7-[(1R,2S)-2-(4,4-dimethyloct-1-enyl)cyclopentyl]-2,2-dihydroxyhept-5-enoic acid.
| Compound Name | 3-bromo-7-[(1R,2S)-2-(4,4-dimethyloct-1-enyl)cyclopentyl]-2,2-dihydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 57112859 |
| Molecular Formula | C22H37BrO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-bromo-7-[(1R,2S)-2-(4,4-dimethyloct-1-enyl)cyclopentyl]-2,2-dihydroxyhept-5-enoic acid |
| SMILES | CCCCC(C)(C)CC=C[C@H]1CCC[C@@H]1CC=CCC(Br)C(O)(O)C(=O)O |
| InChI | InChI=1S/C22H37BrO4/c1-4-5-15-21(2,3)16-9-13-18-12-8-11-17(18)10-6-7-14-19(23)22(26,27)20(24)25/h6-7,9,13,17-19,26-27H,4-5,8,10-12,14-16H2,1-3H3,(H,24,25)/t17-,18+,19?/m0/s1 |
| InChIKey | FEBRYHIQBMQQNA-PAMZHZACSA-N |
| XLogP | 5.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|