C26H36O6 — CID 88840274
7-[(1R,2S)-2-[(E)-4-(4-butylphenoxy)but-1-enyl]cyclopentyl]-2,2,3-trihydroxyhepta-4,5-dienoic acid (PubChem CID 88840274) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is 7-[(1R,2S)-2-[(E)-4-(4-butylphenoxy)but-1-enyl]cyclopentyl]-2,2,3-trihydroxyhepta-4,5-dienoic acid.
| Compound Name | 7-[(1R,2S)-2-[(E)-4-(4-butylphenoxy)but-1-enyl]cyclopentyl]-2,2,3-trihydroxyhepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 88840274 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 7-[(1R,2S)-2-[(E)-4-(4-butylphenoxy)but-1-enyl]cyclopentyl]-2,2,3-trihydroxyhepta-4,5-dienoic acid |
| SMILES | CCCCc1ccc(OCC/C=C/[C@H]2CCC[C@@H]2CC=C=CC(O)C(O)(O)C(=O)O)cc1 |
| InChI | InChI=1S/C26H36O6/c1-2-3-9-20-15-17-23(18-16-20)32-19-7-6-11-22-13-8-12-21(22)10-4-5-14-24(27)26(30,31)25(28)29/h4,6,11,14-18,21-22,24,27,30-31H,2-3,7-10,12-13,19H2,1H3,(H,28,29)/b11-6+/t5?,21-,22-,24?/m0/s1 |
| InChIKey | FJHWDDTXQKTQIX-WTXSYPBDSA-N |
| XLogP | 4.00 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|