C22H27BrO5 — CID 88741726
7-[(1R,2S)-2-[(E)-4-(4-bromophenoxy)but-1-enyl]cyclopentyl]-2,2-dihydroxyhepta-4,5-dienoic acid (PubChem CID 88741726) has the molecular formula C22H27BrO5 and a molecular weight of 451.36 g/mol. Its IUPAC name is 7-[(1R,2S)-2-[(E)-4-(4-bromophenoxy)but-1-enyl]cyclopentyl]-2,2-dihydroxyhepta-4,5-dienoic acid.
| Compound Name | 7-[(1R,2S)-2-[(E)-4-(4-bromophenoxy)but-1-enyl]cyclopentyl]-2,2-dihydroxyhepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 88741726 |
| Molecular Formula | C22H27BrO5 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 7-[(1R,2S)-2-[(E)-4-(4-bromophenoxy)but-1-enyl]cyclopentyl]-2,2-dihydroxyhepta-4,5-dienoic acid |
| SMILES | O=C(O)C(O)(O)CC=C=CC[C@H]1CCC[C@@H]1/C=C/CCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H27BrO5/c23-19-11-13-20(14-12-19)28-16-5-3-8-18-10-6-9-17(18)7-2-1-4-15-22(26,27)21(24)25/h2-4,8,11-14,17-18,26-27H,5-7,9-10,15-16H2,(H,24,25)/b8-3+/t1?,17-,18-/m0/s1 |
| InChIKey | YIJIYBQZHKTETI-NZKURRNLSA-N |
| XLogP | 4.45 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|