C25H32O5 — CID 88518648
methyl 7-[(1R,2R,3R)-3-ethyl-5-oxo-2-[(E)-4-phenoxybut-1-enyl]cyclopentyl]-2-hydroxyhepta-4,5-dienoate (PubChem CID 88518648) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-ethyl-5-oxo-2-[(E)-4-phenoxybut-1-enyl]cyclopentyl]-2-hydroxyhepta-4,5-dienoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-ethyl-5-oxo-2-[(E)-4-phenoxybut-1-enyl]cyclopentyl]-2-hydroxyhepta-4,5-dienoate |
|---|---|
| PubChem CID | 88518648 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-ethyl-5-oxo-2-[(E)-4-phenoxybut-1-enyl]cyclopentyl]-2-hydroxyhepta-4,5-dienoate |
| SMILES | CC[C@@H]1CC(=O)[C@H](CC=C=CCC(O)C(=O)OC)[C@H]1/C=C/CCOc1ccccc1 |
| InChI | InChI=1S/C25H32O5/c1-3-19-18-24(27)22(15-8-5-9-16-23(26)25(28)29-2)21(19)14-10-11-17-30-20-12-6-4-7-13-20/h4,6-10,12-14,19,21-23,26H,3,11,15-18H2,1-2H3/b14-10+/t5?,19-,21+,22-,23?/m1/s1 |
| InChIKey | TWNYSGHFRXXYSP-FOZGFYKKSA-N |
| XLogP | 4.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|