C22H26O6 — CID 88722768
7-[(1R,2R,3S)-3-hydroxy-2-(3-hydroxy-4-phenoxybut-1-enyl)-5-oxocyclopentyl]hepta-4,5-dienoic acid (PubChem CID 88722768) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 7-[(1R,2R,3S)-3-hydroxy-2-(3-hydroxy-4-phenoxybut-1-enyl)-5-oxocyclopentyl]hepta-4,5-dienoic acid.
| Compound Name | 7-[(1R,2R,3S)-3-hydroxy-2-(3-hydroxy-4-phenoxybut-1-enyl)-5-oxocyclopentyl]hepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 88722768 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 7-[(1R,2R,3S)-3-hydroxy-2-(3-hydroxy-4-phenoxybut-1-enyl)-5-oxocyclopentyl]hepta-4,5-dienoic acid |
| SMILES | O=C(O)CCC=C=CC[C@H]1C(=O)C[C@H](O)[C@@H]1C=CC(O)COc1ccccc1 |
| InChI | InChI=1S/C22H26O6/c23-16(15-28-17-8-4-3-5-9-17)12-13-19-18(20(24)14-21(19)25)10-6-1-2-7-11-22(26)27/h2-6,8-9,12-13,16,18-19,21,23,25H,7,10-11,14-15H2,(H,26,27)/t1?,16?,18-,19-,21+/m1/s1 |
| InChIKey | BIFFPOIGTAQJKR-RTAFYLCTSA-N |
| XLogP | 2.51 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|