C25H33NO8 — CID 67896078
methyl 2-[[7-[(1R,2R)-3-hydroxy-2-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]-5-oxoheptanoyl]amino]acetate (PubChem CID 67896078) has the molecular formula C25H33NO8 and a molecular weight of 475.54 g/mol. Its IUPAC name is methyl 2-[[7-[(1R,2R)-3-hydroxy-2-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]-5-oxoheptanoyl]amino]acetate.
| Compound Name | methyl 2-[[7-[(1R,2R)-3-hydroxy-2-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]-5-oxoheptanoyl]amino]acetate |
|---|---|
| PubChem CID | 67896078 |
| Molecular Formula | C25H33NO8 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | methyl 2-[[7-[(1R,2R)-3-hydroxy-2-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]-5-oxoheptanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CCCC(=O)CC[C@H]1C(=O)CC(O)[C@@H]1/C=C/C(O)COc1ccccc1 |
| InChI | InChI=1S/C25H33NO8/c1-33-25(32)15-26-24(31)9-5-6-17(27)10-12-20-21(23(30)14-22(20)29)13-11-18(28)16-34-19-7-3-2-4-8-19/h2-4,7-8,11,13,18,20-21,23,28,30H,5-6,9-10,12,14-16H2,1H3,(H,26,31)/b13-11+/t18?,20-,21-,23?/m1/s1 |
| InChIKey | WSLBTTIQWHNYKA-JFPMZTTDSA-N |
| XLogP | 1.36 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|