C24H34O6S — CID 69048285
methyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate (PubChem CID 69048285) has the molecular formula C24H34O6S and a molecular weight of 450.60 g/mol. Its IUPAC name is methyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate.
| Compound Name | methyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 69048285 |
| Molecular Formula | C24H34O6S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | methyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
| SMILES | COCc1cccc(C[C@H](O)C=C[C@@H]2[C@H](O)CC(=O)[C@@H]2CCSCCCC(=O)OC)c1 |
| InChI | InChI=1S/C24H34O6S/c1-29-16-18-6-3-5-17(13-18)14-19(25)8-9-20-21(23(27)15-22(20)26)10-12-31-11-4-7-24(28)30-2/h3,5-6,8-9,13,19-22,25-26H,4,7,10-12,14-16H2,1-2H3/t19-,20+,21-,22-/m1/s1 |
| InChIKey | FBQUXLIJKPWCAO-CIAFKFPVSA-N |
| XLogP | 2.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|