C32H48O8S — CID 68981850
2-[4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoyloxy]ethyl heptanoate (PubChem CID 68981850) has the molecular formula C32H48O8S and a molecular weight of 592.80 g/mol. Its IUPAC name is 2-[4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoyloxy]ethyl heptanoate.
| Compound Name | 2-[4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoyloxy]ethyl heptanoate |
|---|---|
| PubChem CID | 68981850 |
| Molecular Formula | C32H48O8S |
| Molecular Weight | 592.80 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | 2-[4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoyloxy]ethyl heptanoate |
| SMILES | CCCCCCC(=O)OCCOC(=O)CCCSCC[C@H]1C(=O)C[C@@H](O)[C@H]1/C=C/[C@@H](O)Cc1cccc(COC)c1 |
| InChI | InChI=1S/C32H48O8S/c1-3-4-5-6-11-31(36)39-16-17-40-32(37)12-8-18-41-19-15-28-27(29(34)22-30(28)35)14-13-26(33)21-24-9-7-10-25(20-24)23-38-2/h7,9-10,13-14,20,26-29,33-34H,3-6,8,11-12,15-19,21-23H2,1-2H3/b14-13+/t26-,27+,28-,29-/m1/s1 |
| InChIKey | WROKNCYQKNECPC-FFPWAJIGSA-N |
| XLogP | 4.82 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|