C29H42O8S — CID 69291281
4-[2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoyloxymethyl 2,2-dimethylpropanoate (PubChem CID 69291281) has the molecular formula C29H42O8S and a molecular weight of 550.71 g/mol. Its IUPAC name is 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoyloxymethyl 2,2-dimethylpropanoate.
| Compound Name | 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoyloxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 69291281 |
| Molecular Formula | C29H42O8S |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoyloxymethyl 2,2-dimethylpropanoate |
| SMILES | COCc1cccc(C[C@H](O)C=C[C@H]2[C@H](O)CC(=O)[C@@H]2CCSCCCC(=O)OCOC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C29H42O8S/c1-29(2,3)28(34)37-19-36-27(33)9-6-13-38-14-12-24-23(25(31)17-26(24)32)11-10-22(30)16-20-7-5-8-21(15-20)18-35-4/h5,7-8,10-11,15,22-25,30-31H,6,9,12-14,16-19H2,1-4H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | DMPFEOKBPNXMBU-ZGFBMJKBSA-N |
| XLogP | 3.85 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|