C31H48O7S — CID 69292429
2-hexoxyethyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate (PubChem CID 69292429) has the molecular formula C31H48O7S and a molecular weight of 564.79 g/mol. Its IUPAC name is 2-hexoxyethyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate.
| Compound Name | 2-hexoxyethyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 69292429 |
| Molecular Formula | C31H48O7S |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | 2-hexoxyethyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
| SMILES | CCCCCCOCCOC(=O)CCCSCC[C@H]1C(=O)C[C@@H](O)[C@@H]1C=C[C@@H](O)Cc1cccc(COC)c1 |
| InChI | InChI=1S/C31H48O7S/c1-3-4-5-6-15-37-16-17-38-31(35)11-8-18-39-19-14-28-27(29(33)22-30(28)34)13-12-26(32)21-24-9-7-10-25(20-24)23-36-2/h7,9-10,12-13,20,26-29,32-33H,3-6,8,11,14-19,21-23H2,1-2H3/t26-,27-,28-,29-/m1/s1 |
| InChIKey | GQTUKSPWCCVDNX-CXDXLJMYSA-N |
| XLogP | 4.90 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|