C22H26O6 — CID 18638381
2,2-dihydroxy-7-[(1R,5R)-2-oxo-5-[(E)-4-phenoxybut-1-enyl]cyclopentyl]hepta-4,5-dienoic acid (PubChem CID 18638381) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 2,2-dihydroxy-7-[(1R,5R)-2-oxo-5-[(E)-4-phenoxybut-1-enyl]cyclopentyl]hepta-4,5-dienoic acid.
| Compound Name | 2,2-dihydroxy-7-[(1R,5R)-2-oxo-5-[(E)-4-phenoxybut-1-enyl]cyclopentyl]hepta-4,5-dienoic acid |
|---|---|
| PubChem CID | 18638381 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2,2-dihydroxy-7-[(1R,5R)-2-oxo-5-[(E)-4-phenoxybut-1-enyl]cyclopentyl]hepta-4,5-dienoic acid |
| SMILES | O=C1CC[C@H](/C=C/CCOc2ccccc2)[C@H]1CC=C=CCC(O)(O)C(=O)O |
| InChI | InChI=1S/C22H26O6/c23-20-14-13-17(9-6-8-16-28-18-10-3-1-4-11-18)19(20)12-5-2-7-15-22(26,27)21(24)25/h1,3-7,9-11,17,19,26-27H,8,12-16H2,(H,24,25)/b9-6+/t2?,17-,19+/m0/s1 |
| InChIKey | LOGXQBGDQWDLMX-BDOOEIADSA-N |
| XLogP | 2.86 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|