C20H31NO5 — CID 70619273
7-[(1R,2R)-2-(7-cyanohept-1-enyl)-5-oxocyclopentyl]-2,2-dihydroxyheptanoic acid (PubChem CID 70619273) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(7-cyanohept-1-enyl)-5-oxocyclopentyl]-2,2-dihydroxyheptanoic acid.
| Compound Name | 7-[(1R,2R)-2-(7-cyanohept-1-enyl)-5-oxocyclopentyl]-2,2-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 70619273 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 7-[(1R,2R)-2-(7-cyanohept-1-enyl)-5-oxocyclopentyl]-2,2-dihydroxyheptanoic acid |
| SMILES | N#CCCCCCC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(O)(O)C(=O)O |
| InChI | InChI=1S/C20H31NO5/c21-15-9-4-2-1-3-6-10-16-12-13-18(22)17(16)11-7-5-8-14-20(25,26)19(23)24/h6,10,16-17,25-26H,1-5,7-9,11-14H2,(H,23,24)/t16-,17+/m0/s1 |
| InChIKey | QLXGFBUPHOZHCD-DLBZAZTESA-N |
| XLogP | 3.33 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|